C11H14N2O2S — CID 115725174
2-(furan-2-yl)-2-[1-(1,3-thiazol-5-yl)ethylamino]ethanol (PubChem CID 115725174) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-(furan-2-yl)-2-[1-(1,3-thiazol-5-yl)ethylamino]ethanol.
| Compound Name | 2-(furan-2-yl)-2-[1-(1,3-thiazol-5-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 115725174 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-(furan-2-yl)-2-[1-(1,3-thiazol-5-yl)ethylamino]ethanol |
| SMILES | CC(NC(CO)c1ccco1)c1cncs1 |
| InChI | InChI=1S/C11H14N2O2S/c1-8(11-5-12-7-16-11)13-9(6-14)10-3-2-4-15-10/h2-5,7-9,13-14H,6H2,1H3 |
| InChIKey | NGMXWYDHJFYKHV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |