C8H14N2S2 — CID 115706170
N-(2-methylsulfanylethyl)-1-(1,3-thiazol-5-yl)ethanamine (PubChem CID 115706170) has the molecular formula C8H14N2S2 and a molecular weight of 202.35 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-1-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | N-(2-methylsulfanylethyl)-1-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 115706170 |
| Molecular Formula | C8H14N2S2 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | N-(2-methylsulfanylethyl)-1-(1,3-thiazol-5-yl)ethanamine |
| SMILES | CSCCNC(C)c1cncs1 |
| InChI | InChI=1S/C8H14N2S2/c1-7(10-3-4-11-2)8-5-9-6-12-8/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | QWCGKXIXEQPWRY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|