C10H18N2O2S — CID 115897202
1-methoxy-4-[1-(1,3-thiazol-5-yl)ethylamino]butan-2-ol (PubChem CID 115897202) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 1-methoxy-4-[1-(1,3-thiazol-5-yl)ethylamino]butan-2-ol.
| Compound Name | 1-methoxy-4-[1-(1,3-thiazol-5-yl)ethylamino]butan-2-ol |
|---|---|
| PubChem CID | 115897202 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-methoxy-4-[1-(1,3-thiazol-5-yl)ethylamino]butan-2-ol |
| SMILES | COCC(O)CCNC(C)c1cncs1 |
| InChI | InChI=1S/C10H18N2O2S/c1-8(10-5-11-7-15-10)12-4-3-9(13)6-14-2/h5,7-9,12-13H,3-4,6H2,1-2H3 |
| InChIKey | AEYBHULTEPSZDH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |