C8H15N3O2S2 — CID 115713369
N-[2-[1-(1,3-thiazol-5-yl)ethylamino]ethyl]methanesulfonamide (PubChem CID 115713369) has the molecular formula C8H15N3O2S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[2-[1-(1,3-thiazol-5-yl)ethylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[1-(1,3-thiazol-5-yl)ethylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 115713369 |
| Molecular Formula | C8H15N3O2S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-[2-[1-(1,3-thiazol-5-yl)ethylamino]ethyl]methanesulfonamide |
| SMILES | CC(NCCNS(C)(=O)=O)c1cncs1 |
| InChI | InChI=1S/C8H15N3O2S2/c1-7(8-5-9-6-14-8)10-3-4-11-15(2,12)13/h5-7,10-11H,3-4H2,1-2H3 |
| InChIKey | BNRJWDXZKRGRNR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|