C11H19N3OS — CID 115712604
N,N-diethyl-2-[1-(1,3-thiazol-5-yl)ethylamino]acetamide (PubChem CID 115712604) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is N,N-diethyl-2-[1-(1,3-thiazol-5-yl)ethylamino]acetamide.
| Compound Name | N,N-diethyl-2-[1-(1,3-thiazol-5-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 115712604 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N,N-diethyl-2-[1-(1,3-thiazol-5-yl)ethylamino]acetamide |
| SMILES | CCN(CC)C(=O)CNC(C)c1cncs1 |
| InChI | InChI=1S/C11H19N3OS/c1-4-14(5-2)11(15)7-13-9(3)10-6-12-8-16-10/h6,8-9,13H,4-5,7H2,1-3H3 |
| InChIKey | LHNXPSZKXXSPDO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |