C13H22N2S — CID 105030739
1-cycloheptyl-3-(1,3-thiazol-5-yl)propan-2-amine (PubChem CID 105030739) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-cycloheptyl-3-(1,3-thiazol-5-yl)propan-2-amine.
| Compound Name | 1-cycloheptyl-3-(1,3-thiazol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 105030739 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-cycloheptyl-3-(1,3-thiazol-5-yl)propan-2-amine |
| SMILES | NC(Cc1cncs1)CC1CCCCCC1 |
| InChI | InChI=1S/C13H22N2S/c14-12(8-13-9-15-10-16-13)7-11-5-3-1-2-4-6-11/h9-12H,1-8,14H2 |
| InChIKey | IFPUBWQMRYITRA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |