C12H20N2S — CID 105014924
1-cyclohexyl-3-(1,3-thiazol-2-yl)propan-2-amine (PubChem CID 105014924) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1,3-thiazol-2-yl)propan-2-amine.
| Compound Name | 1-cyclohexyl-3-(1,3-thiazol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 105014924 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-cyclohexyl-3-(1,3-thiazol-2-yl)propan-2-amine |
| SMILES | NC(Cc1nccs1)CC1CCCCC1 |
| InChI | InChI=1S/C12H20N2S/c13-11(9-12-14-6-7-15-12)8-10-4-2-1-3-5-10/h6-7,10-11H,1-5,8-9,13H2 |
| InChIKey | XCUGQAPOFRYDPS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |