C11H17NOS — CID 79824321
1-cyclohexyl-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 79824321) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 1-cyclohexyl-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-cyclohexyl-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79824321 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-cyclohexyl-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nccs1)C1CCCCC1 |
| InChI | InChI=1S/C11H17NOS/c13-10(8-11-12-6-7-14-11)9-4-2-1-3-5-9/h6-7,9-10,13H,1-5,8H2 |
| InChIKey | NCIODVRBHHDWOV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |