C12H19N3S — CID 105324654
[1-(7-bicyclo[4.1.0]heptanyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105324654) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is [1-(7-bicyclo[4.1.0]heptanyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(7-bicyclo[4.1.0]heptanyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105324654 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | [1-(7-bicyclo[4.1.0]heptanyl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1nccs1)C1C2CCCCC21 |
| InChI | InChI=1S/C12H19N3S/c13-15-10(7-11-14-5-6-16-11)12-8-3-1-2-4-9(8)12/h5-6,8-10,12,15H,1-4,7,13H2 |
| InChIKey | MOCZRIBSZDSVRO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|