C11H15NOS — CID 115822466
1-(6-bicyclo[3.1.0]hexanyl)-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 115822466) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(6-bicyclo[3.1.0]hexanyl)-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 115822466 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nccs1)C1C2CCCC21 |
| InChI | InChI=1S/C11H15NOS/c13-9(6-10-12-4-5-14-10)11-7-2-1-3-8(7)11/h4-5,7-9,11,13H,1-3,6H2 |
| InChIKey | RCICFZDOURVWJZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |