C9H14N2OS — CID 164654104
1-[(2R)-pyrrolidin-2-yl]-2-(1,3-thiazol-2-yl)ethanol (PubChem CID 164654104) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-[(2R)-pyrrolidin-2-yl]-2-(1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-[(2R)-pyrrolidin-2-yl]-2-(1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 164654104 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-[(2R)-pyrrolidin-2-yl]-2-(1,3-thiazol-2-yl)ethanol |
| SMILES | OC(Cc1nccs1)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H14N2OS/c12-8(7-2-1-3-10-7)6-9-11-4-5-13-9/h4-5,7-8,10,12H,1-3,6H2/t7-,8?/m1/s1 |
| InChIKey | BCGSXQWNBUFRDU-GVHYBUMESA-N |
| XLogP | 0.80 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |