C12H16F3NOS — CID 105115363
2-(1,3-thiazol-2-yl)-1-[4-(trifluoromethyl)cyclohexyl]ethanol (PubChem CID 105115363) has the molecular formula C12H16F3NOS and a molecular weight of 279.33 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-1-[4-(trifluoromethyl)cyclohexyl]ethanol.
| Compound Name | 2-(1,3-thiazol-2-yl)-1-[4-(trifluoromethyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 105115363 |
| Molecular Formula | C12H16F3NOS |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-1-[4-(trifluoromethyl)cyclohexyl]ethanol |
| SMILES | OC(Cc1nccs1)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H16F3NOS/c13-12(14,15)9-3-1-8(2-4-9)10(17)7-11-16-5-6-18-11/h5-6,8-10,17H,1-4,7H2 |
| InChIKey | KJCAKPNPSJOBBU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |