C13H16BrF3OS — CID 105091001
2-(3-bromothiophen-2-yl)-1-[4-(trifluoromethyl)cyclohexyl]ethanol (PubChem CID 105091001) has the molecular formula C13H16BrF3OS and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-[4-(trifluoromethyl)cyclohexyl]ethanol.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-[4-(trifluoromethyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 105091001 |
| Molecular Formula | C13H16BrF3OS |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-[4-(trifluoromethyl)cyclohexyl]ethanol |
| SMILES | OC(Cc1sccc1Br)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H16BrF3OS/c14-10-5-6-19-12(10)7-11(18)8-1-3-9(4-2-8)13(15,16)17/h5-6,8-9,11,18H,1-4,7H2 |
| InChIKey | AIBAVRUVKYWOCM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |