C10H13BrO2S — CID 65148115
2-(3-bromothiophen-2-yl)-1-(oxolan-3-yl)ethanol (PubChem CID 65148115) has the molecular formula C10H13BrO2S and a molecular weight of 277.18 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(oxolan-3-yl)ethanol.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(oxolan-3-yl)ethanol |
|---|---|
| PubChem CID | 65148115 |
| Molecular Formula | C10H13BrO2S |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(oxolan-3-yl)ethanol |
| SMILES | OC(Cc1sccc1Br)C1CCOC1 |
| InChI | InChI=1S/C10H13BrO2S/c11-8-2-4-14-10(8)5-9(12)7-1-3-13-6-7/h2,4,7,9,12H,1,3,5-6H2 |
| InChIKey | QVCHJWNUGZVIPL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |