C12H14ClFO2 — CID 103038984
2-(3-chloro-4-fluorophenyl)-1-(oxolan-3-yl)ethanol (PubChem CID 103038984) has the molecular formula C12H14ClFO2 and a molecular weight of 244.69 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1-(oxolan-3-yl)ethanol.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1-(oxolan-3-yl)ethanol |
|---|---|
| PubChem CID | 103038984 |
| Molecular Formula | C12H14ClFO2 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1-(oxolan-3-yl)ethanol |
| SMILES | OC(Cc1ccc(F)c(Cl)c1)C1CCOC1 |
| InChI | InChI=1S/C12H14ClFO2/c13-10-5-8(1-2-11(10)14)6-12(15)9-3-4-16-7-9/h1-2,5,9,12,15H,3-4,6-7H2 |
| InChIKey | ZFPCSBCQEVCGLC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |