C14H18ClFOS — CID 103039599
1-(3-chloro-4-fluorophenyl)-3-cyclopentylsulfanylpropan-2-ol (PubChem CID 103039599) has the molecular formula C14H18ClFOS and a molecular weight of 288.81 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-cyclopentylsulfanylpropan-2-ol.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-cyclopentylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 103039599 |
| Molecular Formula | C14H18ClFOS |
| Molecular Weight | 288.81 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-cyclopentylsulfanylpropan-2-ol |
| SMILES | OC(CSC1CCCC1)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClFOS/c15-13-8-10(5-6-14(13)16)7-11(17)9-18-12-3-1-2-4-12/h5-6,8,11-12,17H,1-4,7,9H2 |
| InChIKey | WYSATLBWZHUROW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |