C15H13BrClFOS — CID 103039620
1-(4-bromophenyl)sulfanyl-3-(3-chloro-4-fluorophenyl)propan-2-ol (PubChem CID 103039620) has the molecular formula C15H13BrClFOS and a molecular weight of 375.69 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-3-(3-chloro-4-fluorophenyl)propan-2-ol.
| Compound Name | 1-(4-bromophenyl)sulfanyl-3-(3-chloro-4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 103039620 |
| Molecular Formula | C15H13BrClFOS |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-3-(3-chloro-4-fluorophenyl)propan-2-ol |
| SMILES | OC(CSc1ccc(Br)cc1)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H13BrClFOS/c16-11-2-4-13(5-3-11)20-9-12(19)7-10-1-6-15(18)14(17)8-10/h1-6,8,12,19H,7,9H2 |
| InChIKey | KYIWROXKJAHZLD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |