C17H19ClOS — CID 66143568
1-(4-chlorophenyl)sulfanyl-3-(3,5-dimethylphenyl)propan-2-ol (PubChem CID 66143568) has the molecular formula C17H19ClOS and a molecular weight of 306.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfanyl-3-(3,5-dimethylphenyl)propan-2-ol.
| Compound Name | 1-(4-chlorophenyl)sulfanyl-3-(3,5-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 66143568 |
| Molecular Formula | C17H19ClOS |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1-(4-chlorophenyl)sulfanyl-3-(3,5-dimethylphenyl)propan-2-ol |
| SMILES | Cc1cc(C)cc(CC(O)CSc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H19ClOS/c1-12-7-13(2)9-14(8-12)10-16(19)11-20-17-5-3-15(18)4-6-17/h3-9,16,19H,10-11H2,1-2H3 |
| InChIKey | BXLVDBFSGNARPL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |