C16H17ClO2S — CID 35672224
(2R)-1-(4-chlorophenoxy)-3-(4-methylphenyl)sulfanylpropan-2-ol (PubChem CID 35672224) has the molecular formula C16H17ClO2S and a molecular weight of 308.83 g/mol. Its IUPAC name is (2R)-1-(4-chlorophenoxy)-3-(4-methylphenyl)sulfanylpropan-2-ol.
| Compound Name | (2R)-1-(4-chlorophenoxy)-3-(4-methylphenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 35672224 |
| Molecular Formula | C16H17ClO2S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (2R)-1-(4-chlorophenoxy)-3-(4-methylphenyl)sulfanylpropan-2-ol |
| SMILES | Cc1ccc(SC[C@H](O)COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H17ClO2S/c1-12-2-8-16(9-3-12)20-11-14(18)10-19-15-6-4-13(17)5-7-15/h2-9,14,18H,10-11H2,1H3/t14-/m1/s1 |
| InChIKey | LHEVISICGQGQTD-CQSZACIVSA-N |
| XLogP | 4.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |