C10H13ClOS — CID 22247728
1-(4-chlorophenyl)sulfanylbutan-2-ol (PubChem CID 22247728) has the molecular formula C10H13ClOS and a molecular weight of 216.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfanylbutan-2-ol.
| Compound Name | 1-(4-chlorophenyl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 22247728 |
| Molecular Formula | C10H13ClOS |
| Molecular Weight | 216.73 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1-(4-chlorophenyl)sulfanylbutan-2-ol |
| SMILES | CCC(O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClOS/c1-2-9(12)7-13-10-5-3-8(11)4-6-10/h3-6,9,12H,2,7H2,1H3 |
| InChIKey | MICBSWQIGARZCN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |