C16H16BrFOS — CID 105373485
1-(4-bromophenyl)sulfanyl-3-(5-fluoro-2-methylphenyl)propan-2-ol (PubChem CID 105373485) has the molecular formula C16H16BrFOS and a molecular weight of 355.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-3-(5-fluoro-2-methylphenyl)propan-2-ol.
| Compound Name | 1-(4-bromophenyl)sulfanyl-3-(5-fluoro-2-methylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 105373485 |
| Molecular Formula | C16H16BrFOS |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-3-(5-fluoro-2-methylphenyl)propan-2-ol |
| SMILES | Cc1ccc(F)cc1CC(O)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrFOS/c1-11-2-5-14(18)8-12(11)9-15(19)10-20-16-6-3-13(17)4-7-16/h2-8,15,19H,9-10H2,1H3 |
| InChIKey | JXSKGIPWAJQZHT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |