C15H13Br2FOS — CID 66161561
1-(2-bromo-5-fluorophenyl)-3-(3-bromophenyl)sulfanylpropan-2-ol (PubChem CID 66161561) has the molecular formula C15H13Br2FOS and a molecular weight of 420.14 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-3-(3-bromophenyl)sulfanylpropan-2-ol.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-3-(3-bromophenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 66161561 |
| Molecular Formula | C15H13Br2FOS |
| Molecular Weight | 420.14 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-3-(3-bromophenyl)sulfanylpropan-2-ol |
| SMILES | OC(CSc1cccc(Br)c1)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C15H13Br2FOS/c16-11-2-1-3-14(8-11)20-9-13(19)7-10-6-12(18)4-5-15(10)17/h1-6,8,13,19H,7,9H2 |
| InChIKey | PGYIJAZQUCUQNX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.14 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |