C16H16BrFO2S — CID 66070196
1-(2-bromo-5-methoxyphenyl)-3-(3-fluorophenyl)sulfanylpropan-2-ol (PubChem CID 66070196) has the molecular formula C16H16BrFO2S and a molecular weight of 371.27 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-3-(3-fluorophenyl)sulfanylpropan-2-ol.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-3-(3-fluorophenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 66070196 |
| Molecular Formula | C16H16BrFO2S |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-3-(3-fluorophenyl)sulfanylpropan-2-ol |
| SMILES | COc1ccc(Br)c(CC(O)CSc2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H16BrFO2S/c1-20-14-5-6-16(17)11(8-14)7-13(19)10-21-15-4-2-3-12(18)9-15/h2-6,8-9,13,19H,7,10H2,1H3 |
| InChIKey | BURIYMARGSBOAF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |