C16H14BrFO3 — CID 79431080
3-(2-bromo-5-methoxyphenyl)-2-(3-fluorophenyl)propanoic acid (PubChem CID 79431080) has the molecular formula C16H14BrFO3 and a molecular weight of 353.19 g/mol. Its IUPAC name is 3-(2-bromo-5-methoxyphenyl)-2-(3-fluorophenyl)propanoic acid.
| Compound Name | 3-(2-bromo-5-methoxyphenyl)-2-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 79431080 |
| Molecular Formula | C16H14BrFO3 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 3-(2-bromo-5-methoxyphenyl)-2-(3-fluorophenyl)propanoic acid |
| SMILES | COc1ccc(Br)c(CC(C(=O)O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H14BrFO3/c1-21-13-5-6-15(17)11(8-13)9-14(16(19)20)10-3-2-4-12(18)7-10/h2-8,14H,9H2,1H3,(H,19,20) |
| InChIKey | JCKHPVZNTJXQOC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |