C19H22O6 — CID 112721448
3-(2,5-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)propanoic acid (PubChem CID 112721448) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-(2,5-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 112721448 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(OC)c(CC(C(=O)O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C19H22O6/c1-22-14-6-8-16(23-2)13(9-14)10-15(19(20)21)12-5-7-17(24-3)18(11-12)25-4/h5-9,11,15H,10H2,1-4H3,(H,20,21) |
| InChIKey | UYYXCGZEZVWTOO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |