C19H22O5 — CID 83956153
3-(2,5-dimethoxyphenyl)-2-(3-ethoxyphenyl)propanoic acid (PubChem CID 83956153) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-2-(3-ethoxyphenyl)propanoic acid.
| Compound Name | 3-(2,5-dimethoxyphenyl)-2-(3-ethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 83956153 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-2-(3-ethoxyphenyl)propanoic acid |
| SMILES | CCOc1cccc(C(Cc2cc(OC)ccc2OC)C(=O)O)c1 |
| InChI | InChI=1S/C19H22O5/c1-4-24-16-7-5-6-13(10-16)17(19(20)21)12-14-11-15(22-2)8-9-18(14)23-3/h5-11,17H,4,12H2,1-3H3,(H,20,21) |
| InChIKey | BLXGMOKYFYLPTF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |