C16H16Br2O2S — CID 66142881
1-(2-bromo-5-methoxyphenyl)-3-(2-bromophenyl)sulfanylpropan-2-ol (PubChem CID 66142881) has the molecular formula C16H16Br2O2S and a molecular weight of 432.18 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-3-(2-bromophenyl)sulfanylpropan-2-ol.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-3-(2-bromophenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 66142881 |
| Molecular Formula | C16H16Br2O2S |
| Molecular Weight | 432.18 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-3-(2-bromophenyl)sulfanylpropan-2-ol |
| SMILES | COc1ccc(Br)c(CC(O)CSc2ccccc2Br)c1 |
| InChI | InChI=1S/C16H16Br2O2S/c1-20-13-6-7-14(17)11(9-13)8-12(19)10-21-16-5-3-2-4-15(16)18/h2-7,9,12,19H,8,10H2,1H3 |
| InChIKey | KDQDGXNSGLRNBC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.18 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |