C14H21BrO2S — CID 65325108
1-(2-bromo-5-methoxyphenyl)-3-butan-2-ylsulfanylpropan-2-ol (PubChem CID 65325108) has the molecular formula C14H21BrO2S and a molecular weight of 333.29 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-3-butan-2-ylsulfanylpropan-2-ol.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-3-butan-2-ylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 65325108 |
| Molecular Formula | C14H21BrO2S |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-3-butan-2-ylsulfanylpropan-2-ol |
| SMILES | CCC(C)SCC(O)Cc1cc(OC)ccc1Br |
| InChI | InChI=1S/C14H21BrO2S/c1-4-10(2)18-9-12(16)7-11-8-13(17-3)5-6-14(11)15/h5-6,8,10,12,16H,4,7,9H2,1-3H3 |
| InChIKey | NKWDWVYEKIBFNB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |