C17H20BrNO2 — CID 115862312
2-(2-bromo-5-methoxyphenyl)-1-(4-ethoxyphenyl)ethanamine (PubChem CID 115862312) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxyphenyl)-1-(4-ethoxyphenyl)ethanamine.
| Compound Name | 2-(2-bromo-5-methoxyphenyl)-1-(4-ethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 115862312 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-(2-bromo-5-methoxyphenyl)-1-(4-ethoxyphenyl)ethanamine |
| SMILES | CCOc1ccc(C(N)Cc2cc(OC)ccc2Br)cc1 |
| InChI | InChI=1S/C17H20BrNO2/c1-3-21-14-6-4-12(5-7-14)17(19)11-13-10-15(20-2)8-9-16(13)18/h4-10,17H,3,11,19H2,1-2H3 |
| InChIKey | DELOWVSHXLLUCU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |