C14H22BrNO3 — CID 79495380
3-(2-bromo-5-methoxyphenyl)-1,1-diethoxypropan-2-amine (PubChem CID 79495380) has the molecular formula C14H22BrNO3 and a molecular weight of 332.24 g/mol. Its IUPAC name is 3-(2-bromo-5-methoxyphenyl)-1,1-diethoxypropan-2-amine.
| Compound Name | 3-(2-bromo-5-methoxyphenyl)-1,1-diethoxypropan-2-amine |
|---|---|
| PubChem CID | 79495380 |
| Molecular Formula | C14H22BrNO3 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 3-(2-bromo-5-methoxyphenyl)-1,1-diethoxypropan-2-amine |
| SMILES | CCOC(OCC)C(N)Cc1cc(OC)ccc1Br |
| InChI | InChI=1S/C14H22BrNO3/c1-4-18-14(19-5-2)13(16)9-10-8-11(17-3)6-7-12(10)15/h6-8,13-14H,4-5,9,16H2,1-3H3 |
| InChIKey | ZGLJJTCBENUCEY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|