C15H14BrCl2NO — CID 115862161
2-(2-bromo-5-methoxyphenyl)-1-(2,6-dichlorophenyl)ethanamine (PubChem CID 115862161) has the molecular formula C15H14BrCl2NO and a molecular weight of 375.09 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxyphenyl)-1-(2,6-dichlorophenyl)ethanamine.
| Compound Name | 2-(2-bromo-5-methoxyphenyl)-1-(2,6-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 115862161 |
| Molecular Formula | C15H14BrCl2NO |
| Molecular Weight | 375.09 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 2-(2-bromo-5-methoxyphenyl)-1-(2,6-dichlorophenyl)ethanamine |
| SMILES | COc1ccc(Br)c(CC(N)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C15H14BrCl2NO/c1-20-10-5-6-11(16)9(7-10)8-14(19)15-12(17)3-2-4-13(15)18/h2-7,14H,8,19H2,1H3 |
| InChIKey | GNJORJUDPMDELR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.09 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |