C15H23BrO3 — CID 116752716
1-(2-bromo-5-methoxyphenyl)-3-ethyl-3-methoxypentan-2-ol (PubChem CID 116752716) has the molecular formula C15H23BrO3 and a molecular weight of 331.25 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-3-ethyl-3-methoxypentan-2-ol.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-3-ethyl-3-methoxypentan-2-ol |
|---|---|
| PubChem CID | 116752716 |
| Molecular Formula | C15H23BrO3 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-3-ethyl-3-methoxypentan-2-ol |
| SMILES | CCC(CC)(OC)C(O)Cc1cc(OC)ccc1Br |
| InChI | InChI=1S/C15H23BrO3/c1-5-15(6-2,19-4)14(17)10-11-9-12(18-3)7-8-13(11)16/h7-9,14,17H,5-6,10H2,1-4H3 |
| InChIKey | BNHWJGVWLKRZOG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |