C15H13F3OS — CID 66071849
1-(2,4-difluorophenyl)-3-(3-fluorophenyl)sulfanylpropan-2-ol (PubChem CID 66071849) has the molecular formula C15H13F3OS and a molecular weight of 298.33 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3-fluorophenyl)sulfanylpropan-2-ol.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3-fluorophenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 66071849 |
| Molecular Formula | C15H13F3OS |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3-fluorophenyl)sulfanylpropan-2-ol |
| SMILES | OC(CSc1cccc(F)c1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H13F3OS/c16-11-2-1-3-14(7-11)20-9-13(19)6-10-4-5-12(17)8-15(10)18/h1-5,7-8,13,19H,6,9H2 |
| InChIKey | OGVRJEKDXCYREC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |