C13H16Cl2OS — CID 60981166
2-cyclopentylsulfanyl-1-(2,5-dichlorophenyl)ethanol (PubChem CID 60981166) has the molecular formula C13H16Cl2OS and a molecular weight of 291.24 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-(2,5-dichlorophenyl)ethanol.
| Compound Name | 2-cyclopentylsulfanyl-1-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 60981166 |
| Molecular Formula | C13H16Cl2OS |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-(2,5-dichlorophenyl)ethanol |
| SMILES | OC(CSC1CCCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H16Cl2OS/c14-9-5-6-12(15)11(7-9)13(16)8-17-10-3-1-2-4-10/h5-7,10,13,16H,1-4,8H2 |
| InChIKey | GHRGWPJZWBAHCZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |