C14H20Cl2N2S — CID 105227623
[1-cyclopentylsulfanyl-3-(2,5-dichlorophenyl)propan-2-yl]hydrazine (PubChem CID 105227623) has the molecular formula C14H20Cl2N2S and a molecular weight of 319.30 g/mol. Its IUPAC name is [1-cyclopentylsulfanyl-3-(2,5-dichlorophenyl)propan-2-yl]hydrazine.
| Compound Name | [1-cyclopentylsulfanyl-3-(2,5-dichlorophenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105227623 |
| Molecular Formula | C14H20Cl2N2S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [1-cyclopentylsulfanyl-3-(2,5-dichlorophenyl)propan-2-yl]hydrazine |
| SMILES | NNC(CSC1CCCC1)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H20Cl2N2S/c15-11-5-6-14(16)10(7-11)8-12(18-17)9-19-13-3-1-2-4-13/h5-7,12-13,18H,1-4,8-9,17H2 |
| InChIKey | ZTIISFOFVJYWAC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|