C14H19FOS — CID 65138964
2-cyclopentylsulfanyl-1-(4-fluoro-2-methylphenyl)ethanol (PubChem CID 65138964) has the molecular formula C14H19FOS and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-(4-fluoro-2-methylphenyl)ethanol.
| Compound Name | 2-cyclopentylsulfanyl-1-(4-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 65138964 |
| Molecular Formula | C14H19FOS |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-(4-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1cc(F)ccc1C(O)CSC1CCCC1 |
| InChI | InChI=1S/C14H19FOS/c1-10-8-11(15)6-7-13(10)14(16)9-17-12-4-2-3-5-12/h6-8,12,14,16H,2-5,9H2,1H3 |
| InChIKey | MJEMBJLGSGVDGX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |