C14H19FO2S — CID 82770118
2-cyclopentylsulfanyl-1-(5-fluoro-2-methoxyphenyl)ethanol (PubChem CID 82770118) has the molecular formula C14H19FO2S and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-(5-fluoro-2-methoxyphenyl)ethanol.
| Compound Name | 2-cyclopentylsulfanyl-1-(5-fluoro-2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 82770118 |
| Molecular Formula | C14H19FO2S |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-(5-fluoro-2-methoxyphenyl)ethanol |
| SMILES | COc1ccc(F)cc1C(O)CSC1CCCC1 |
| InChI | InChI=1S/C14H19FO2S/c1-17-14-7-6-10(15)8-12(14)13(16)9-18-11-4-2-3-5-11/h6-8,11,13,16H,2-5,9H2,1H3 |
| InChIKey | KDQIGUMFTQXBBJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |