About 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol
2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol (PubChem CID 65138645) has the molecular formula C15H22OS
and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol.
Molecular Properties
| Compound Name | 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol |
| PubChem CID | 65138645 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol |
| SMILES | Cc1cccc(C(O)CSC2CCCC2)c1C |
| InChI | InChI=1S/C15H22OS/c1-11-6-5-9-14(12(11)2)15(16)10-17-13-7-3-4-8-13/h5-6,9,13,15-16H,3-4,7-8,10H2,1-2H3 |
| InChIKey | QNENRLIVWZVNRN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol?
The IUPAC name of 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol (CID 65138645) is 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol.
What is the SMILES notation for 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol?
The canonical SMILES for 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol is Cc1cccc(C(O)CSC2CCCC2)c1C.
What is the InChIKey of 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol?
The InChIKey is QNENRLIVWZVNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22OS/c1-11-6-5-9-14(12(11)2)15(16)10-17-13-7-3-4-8-13/h5-6,9,13,15-16H,3-4,7-8,10H2,1-2H3.
What are the key properties of 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol?
2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol has a molecular weight of 250.41 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol is sourced from PubChem (CID 65138645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).