C15H22OS — CID 65138645
2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol (PubChem CID 65138645) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol.
| Compound Name | 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 65138645 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-(2,3-dimethylphenyl)ethanol |
| SMILES | Cc1cccc(C(O)CSC2CCCC2)c1C |
| InChI | InChI=1S/C15H22OS/c1-11-6-5-9-14(12(11)2)15(16)10-17-13-7-3-4-8-13/h5-6,9,13,15-16H,3-4,7-8,10H2,1-2H3 |
| InChIKey | QNENRLIVWZVNRN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |