C16H17BrOS — CID 66144051
2-(2-bromophenyl)sulfanyl-1-(2,3-dimethylphenyl)ethanol (PubChem CID 66144051) has the molecular formula C16H17BrOS and a molecular weight of 337.28 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanyl-1-(2,3-dimethylphenyl)ethanol.
| Compound Name | 2-(2-bromophenyl)sulfanyl-1-(2,3-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 66144051 |
| Molecular Formula | C16H17BrOS |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-(2-bromophenyl)sulfanyl-1-(2,3-dimethylphenyl)ethanol |
| SMILES | Cc1cccc(C(O)CSc2ccccc2Br)c1C |
| InChI | InChI=1S/C16H17BrOS/c1-11-6-5-7-13(12(11)2)15(18)10-19-16-9-4-3-8-14(16)17/h3-9,15,18H,10H2,1-2H3 |
| InChIKey | MBSZDJHZDSJYHY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |