C13H13BrN2OS — CID 66144443
1-(2-amino-3-pyridinyl)-2-(2-bromophenyl)sulfanylethanol (PubChem CID 66144443) has the molecular formula C13H13BrN2OS and a molecular weight of 325.23 g/mol. Its IUPAC name is 1-(2-amino-3-pyridinyl)-2-(2-bromophenyl)sulfanylethanol.
| Compound Name | 1-(2-amino-3-pyridinyl)-2-(2-bromophenyl)sulfanylethanol |
|---|---|
| PubChem CID | 66144443 |
| Molecular Formula | C13H13BrN2OS |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 1-(2-amino-3-pyridinyl)-2-(2-bromophenyl)sulfanylethanol |
| SMILES | Nc1ncccc1C(O)CSc1ccccc1Br |
| InChI | InChI=1S/C13H13BrN2OS/c14-10-5-1-2-6-12(10)18-8-11(17)9-4-3-7-16-13(9)15/h1-7,11,17H,8H2,(H2,15,16) |
| InChIKey | LONWEJZTVZACLM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |