C18H22OS — CID 65139691
2-cyclohexylsulfanyl-1-naphthalen-1-ylethanol (PubChem CID 65139691) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-1-naphthalen-1-ylethanol.
| Compound Name | 2-cyclohexylsulfanyl-1-naphthalen-1-ylethanol |
|---|---|
| PubChem CID | 65139691 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-cyclohexylsulfanyl-1-naphthalen-1-ylethanol |
| SMILES | OC(CSC1CCCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H22OS/c19-18(13-20-15-9-2-1-3-10-15)17-12-6-8-14-7-4-5-11-16(14)17/h4-8,11-12,15,18-19H,1-3,9-10,13H2 |
| InChIKey | CRRQWYORRFUPGT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |