C16H22N2S2 — CID 105227744
[1-(1-benzothiophen-7-yl)-2-cyclohexylsulfanylethyl]hydrazine (PubChem CID 105227744) has the molecular formula C16H22N2S2 and a molecular weight of 306.50 g/mol. Its IUPAC name is [1-(1-benzothiophen-7-yl)-2-cyclohexylsulfanylethyl]hydrazine.
| Compound Name | [1-(1-benzothiophen-7-yl)-2-cyclohexylsulfanylethyl]hydrazine |
|---|---|
| PubChem CID | 105227744 |
| Molecular Formula | C16H22N2S2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [1-(1-benzothiophen-7-yl)-2-cyclohexylsulfanylethyl]hydrazine |
| SMILES | NNC(CSC1CCCCC1)c1cccc2ccsc12 |
| InChI | InChI=1S/C16H22N2S2/c17-18-15(11-20-13-6-2-1-3-7-13)14-8-4-5-12-9-10-19-16(12)14/h4-5,8-10,13,15,18H,1-3,6-7,11,17H2 |
| InChIKey | QAKOWEQVGLAIRT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|