C14H19F3N2OS — CID 105227580
[2-cyclopentylsulfanyl-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine (PubChem CID 105227580) has the molecular formula C14H19F3N2OS and a molecular weight of 320.38 g/mol. Its IUPAC name is [2-cyclopentylsulfanyl-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine.
| Compound Name | [2-cyclopentylsulfanyl-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 105227580 |
| Molecular Formula | C14H19F3N2OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [2-cyclopentylsulfanyl-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine |
| SMILES | NNC(CSC1CCCC1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H19F3N2OS/c15-14(16,17)20-13-8-4-3-7-11(13)12(19-18)9-21-10-5-1-2-6-10/h3-4,7-8,10,12,19H,1-2,5-6,9,18H2 |
| InChIKey | CLDQTBWPVGHGNB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|