C11H15F3N2O2 — CID 105235372
[2-ethoxy-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine (PubChem CID 105235372) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is [2-ethoxy-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine.
| Compound Name | [2-ethoxy-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 105235372 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [2-ethoxy-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine |
| SMILES | CCOCC(NN)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O2/c1-2-17-7-9(16-15)8-5-3-4-6-10(8)18-11(12,13)14/h3-6,9,16H,2,7,15H2,1H3 |
| InChIKey | HXFPIDXQDWEAJM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|