C13H13F3N2OS — CID 105301456
[2-thiophen-3-yl-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine (PubChem CID 105301456) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is [2-thiophen-3-yl-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine.
| Compound Name | [2-thiophen-3-yl-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 105301456 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | [2-thiophen-3-yl-1-[2-(trifluoromethoxy)phenyl]ethyl]hydrazine |
| SMILES | NNC(Cc1ccsc1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2OS/c14-13(15,16)19-12-4-2-1-3-10(12)11(18-17)7-9-5-6-20-8-9/h1-6,8,11,18H,7,17H2 |
| InChIKey | HIHCHKVSTDMTEG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|