C15H20N2OS — CID 105267339
[1-(1-benzothiophen-7-yl)-2-(oxan-2-yl)ethyl]hydrazine (PubChem CID 105267339) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is [1-(1-benzothiophen-7-yl)-2-(oxan-2-yl)ethyl]hydrazine.
| Compound Name | [1-(1-benzothiophen-7-yl)-2-(oxan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105267339 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [1-(1-benzothiophen-7-yl)-2-(oxan-2-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CCCCO1)c1cccc2ccsc12 |
| InChI | InChI=1S/C15H20N2OS/c16-17-14(10-12-5-1-2-8-18-12)13-6-3-4-11-7-9-19-15(11)13/h3-4,6-7,9,12,14,17H,1-2,5,8,10,16H2 |
| InChIKey | NOKTVBFHFMHYQW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|