C14H22N2O2 — CID 105267281
[1-(2-methoxyphenyl)-2-(oxan-2-yl)ethyl]hydrazine (PubChem CID 105267281) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is [1-(2-methoxyphenyl)-2-(oxan-2-yl)ethyl]hydrazine.
| Compound Name | [1-(2-methoxyphenyl)-2-(oxan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105267281 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [1-(2-methoxyphenyl)-2-(oxan-2-yl)ethyl]hydrazine |
| SMILES | COc1ccccc1C(CC1CCCCO1)NN |
| InChI | InChI=1S/C14H22N2O2/c1-17-14-8-3-2-7-12(14)13(16-15)10-11-6-4-5-9-18-11/h2-3,7-8,11,13,16H,4-6,9-10,15H2,1H3 |
| InChIKey | SSFXHWIZCXIEDV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|