C14H19Cl2NO — CID 60900468
2-(cyclopentylmethylamino)-1-(2,5-dichlorophenyl)ethanol (PubChem CID 60900468) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-(cyclopentylmethylamino)-1-(2,5-dichlorophenyl)ethanol.
| Compound Name | 2-(cyclopentylmethylamino)-1-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 60900468 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(cyclopentylmethylamino)-1-(2,5-dichlorophenyl)ethanol |
| SMILES | OC(CNCC1CCCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2NO/c15-11-5-6-13(16)12(7-11)14(18)9-17-8-10-3-1-2-4-10/h5-7,10,14,17-18H,1-4,8-9H2 |
| InChIKey | LRDFUKLKPNKNLM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |