C16H21Br2Cl2NO — CID 70463387
2-[(3,5-dibromocyclooctyl)amino]-1-(2,5-dichlorophenyl)ethanol (PubChem CID 70463387) has the molecular formula C16H21Br2Cl2NO and a molecular weight of 474.06 g/mol. Its IUPAC name is 2-[(3,5-dibromocyclooctyl)amino]-1-(2,5-dichlorophenyl)ethanol.
| Compound Name | 2-[(3,5-dibromocyclooctyl)amino]-1-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 70463387 |
| Molecular Formula | C16H21Br2Cl2NO |
| Molecular Weight | 474.06 g/mol |
| Exact Mass | 470.94 |
| IUPAC Name | 2-[(3,5-dibromocyclooctyl)amino]-1-(2,5-dichlorophenyl)ethanol |
| SMILES | OC(CNC1CCCC(Br)CC(Br)C1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H21Br2Cl2NO/c17-10-2-1-3-13(7-11(18)6-10)21-9-16(22)14-8-12(19)4-5-15(14)20/h4-5,8,10-11,13,16,21-22H,1-3,6-7,9H2 |
| InChIKey | XWISIKODQYPBLE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.06 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|