C20H24ClNO2 — CID 54070827
2-[3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclohexyl]phenol (PubChem CID 54070827) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-[3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclohexyl]phenol.
| Compound Name | 2-[3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclohexyl]phenol |
|---|---|
| PubChem CID | 54070827 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-[3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclohexyl]phenol |
| SMILES | Oc1ccccc1C1CCCC(NC[C@H](O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H24ClNO2/c21-16-7-3-6-15(11-16)20(24)13-22-17-8-4-5-14(12-17)18-9-1-2-10-19(18)23/h1-3,6-7,9-11,14,17,20,22-24H,4-5,8,12-13H2/t14?,17?,20-/m0/s1 |
| InChIKey | MGHWBSJKROXPJM-GAGFWEIESA-N |
| XLogP | 4.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |